C11H13N3O2 — CID 56763854
spiro[1H-pyrido[2,3-d][1,3]oxazine-4,4'-piperidine]-2-one (PubChem CID 56763854) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is spiro[1H-pyrido[2,3-d][1,3]oxazine-4,4'-piperidine]-2-one.
| Compound Name | spiro[1H-pyrido[2,3-d][1,3]oxazine-4,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 56763854 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | spiro[1H-pyrido[2,3-d][1,3]oxazine-4,4'-piperidine]-2-one |
| SMILES | O=C1Nc2ncccc2C2(CCNCC2)O1 |
| InChI | InChI=1S/C11H13N3O2/c15-10-14-9-8(2-1-5-13-9)11(16-10)3-6-12-7-4-11/h1-2,5,12H,3-4,6-7H2,(H,13,14,15) |
| InChIKey | HNGKYJPFWVQZSF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |