About (3-acetyloxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate
(3-acetyloxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate (PubChem CID 567640) has the molecular formula C11H16O6
and a molecular weight of 244.24 g/mol. Its IUPAC name is (3-acetyloxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate.
Molecular Properties
| Compound Name | (3-acetyloxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate |
| PubChem CID | 567640 |
| Molecular Formula | C11H16O6 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | (3-acetyloxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate |
| SMILES | COC1C=CC(OC(C)=O)C(COC(C)=O)O1 |
| InChI | InChI=1S/C11H16O6/c1-7(12)15-6-10-9(16-8(2)13)4-5-11(14-3)17-10/h4-5,9-11H,6H2,1-3H3 |
| InChIKey | VSLFAGQONKVTAA-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3-acetyloxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetyloxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate?
The IUPAC name of (3-acetyloxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate (CID 567640) is (3-acetyloxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate.
What is the SMILES notation for (3-acetyloxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate?
The canonical SMILES for (3-acetyloxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate is COC1C=CC(OC(C)=O)C(COC(C)=O)O1.
What is the InChIKey of (3-acetyloxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate?
The InChIKey is VSLFAGQONKVTAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O6/c1-7(12)15-6-10-9(16-8(2)13)4-5-11(14-3)17-10/h4-5,9-11H,6H2,1-3H3.
What are the key properties of (3-acetyloxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate?
(3-acetyloxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate has a molecular weight of 244.24 g/mol, XLogP of 0.41, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetyloxy-6-methoxy-3,6-dihydro-2H-pyran-2-yl)methyl acetate is sourced from PubChem (CID 567640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).