C20H19NO3 — CID 56764104
N-(2-hydroxy-2-naphthalen-1-ylethyl)-3-methoxybenzamide (PubChem CID 56764104) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-(2-hydroxy-2-naphthalen-1-ylethyl)-3-methoxybenzamide.
| Compound Name | N-(2-hydroxy-2-naphthalen-1-ylethyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 56764104 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | N-(2-hydroxy-2-naphthalen-1-ylethyl)-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NCC(O)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C20H19NO3/c1-24-16-9-4-8-15(12-16)20(23)21-13-19(22)18-11-5-7-14-6-2-3-10-17(14)18/h2-12,19,22H,13H2,1H3,(H,21,23) |
| InChIKey | CKMJLYOKYYVVKY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |