About N-[(2,5-dimethylfuran-3-yl)methyl]-2,2-dimethylpropanamide
N-[(2,5-dimethylfuran-3-yl)methyl]-2,2-dimethylpropanamide (PubChem CID 56765534) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is N-[(2,5-dimethylfuran-3-yl)methyl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[(2,5-dimethylfuran-3-yl)methyl]-2,2-dimethylpropanamide |
| PubChem CID | 56765534 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | N-[(2,5-dimethylfuran-3-yl)methyl]-2,2-dimethylpropanamide |
| SMILES | Cc1cc(CNC(=O)C(C)(C)C)c(C)o1 |
| InChI | InChI=1S/C12H19NO2/c1-8-6-10(9(2)15-8)7-13-11(14)12(3,4)5/h6H,7H2,1-5H3,(H,13,14) |
| InChIKey | LYSNKLGUVULJAV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2,5-dimethylfuran-3-yl)methyl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,5-dimethylfuran-3-yl)methyl]-2,2-dimethylpropanamide?
The IUPAC name of N-[(2,5-dimethylfuran-3-yl)methyl]-2,2-dimethylpropanamide (CID 56765534) is N-[(2,5-dimethylfuran-3-yl)methyl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[(2,5-dimethylfuran-3-yl)methyl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[(2,5-dimethylfuran-3-yl)methyl]-2,2-dimethylpropanamide is Cc1cc(CNC(=O)C(C)(C)C)c(C)o1.
What is the InChIKey of N-[(2,5-dimethylfuran-3-yl)methyl]-2,2-dimethylpropanamide?
The InChIKey is LYSNKLGUVULJAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c1-8-6-10(9(2)15-8)7-13-11(14)12(3,4)5/h6H,7H2,1-5H3,(H,13,14).
What are the key properties of N-[(2,5-dimethylfuran-3-yl)methyl]-2,2-dimethylpropanamide?
N-[(2,5-dimethylfuran-3-yl)methyl]-2,2-dimethylpropanamide has a molecular weight of 209.29 g/mol, XLogP of 2.56, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,5-dimethylfuran-3-yl)methyl]-2,2-dimethylpropanamide is sourced from PubChem (CID 56765534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).