About N-[2-(7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonan-2-yl)-2-oxoethyl]-N-methylmethanesulfonamide
N-[2-(7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonan-2-yl)-2-oxoethyl]-N-methylmethanesulfonamide (PubChem CID 56765694) has the molecular formula C12H22N2O5S
and a molecular weight of 306.38 g/mol. Its IUPAC name is N-[2-(7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonan-2-yl)-2-oxoethyl]-N-methylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[2-(7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonan-2-yl)-2-oxoethyl]-N-methylmethanesulfonamide |
| PubChem CID | 56765694 |
| Molecular Formula | C12H22N2O5S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-[2-(7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonan-2-yl)-2-oxoethyl]-N-methylmethanesulfonamide |
| SMILES | CN(CC(=O)N1CC2(COC(C)(C)OC2)C1)S(C)(=O)=O |
| InChI | InChI=1S/C12H22N2O5S/c1-11(2)18-8-12(9-19-11)6-14(7-12)10(15)5-13(3)20(4,16)17/h5-9H2,1-4H3 |
| InChIKey | QQKCOGGPPBYKKM-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonan-2-yl)-2-oxoethyl]-N-methylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonan-2-yl)-2-oxoethyl]-N-methylmethanesulfonamide?
The IUPAC name of N-[2-(7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonan-2-yl)-2-oxoethyl]-N-methylmethanesulfonamide (CID 56765694) is N-[2-(7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonan-2-yl)-2-oxoethyl]-N-methylmethanesulfonamide.
What is the SMILES notation for N-[2-(7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonan-2-yl)-2-oxoethyl]-N-methylmethanesulfonamide?
The canonical SMILES for N-[2-(7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonan-2-yl)-2-oxoethyl]-N-methylmethanesulfonamide is CN(CC(=O)N1CC2(COC(C)(C)OC2)C1)S(C)(=O)=O.
What is the InChIKey of N-[2-(7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonan-2-yl)-2-oxoethyl]-N-methylmethanesulfonamide?
The InChIKey is QQKCOGGPPBYKKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O5S/c1-11(2)18-8-12(9-19-11)6-14(7-12)10(15)5-13(3)20(4,16)17/h5-9H2,1-4H3.
What are the key properties of N-[2-(7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonan-2-yl)-2-oxoethyl]-N-methylmethanesulfonamide?
N-[2-(7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonan-2-yl)-2-oxoethyl]-N-methylmethanesulfonamide has a molecular weight of 306.38 g/mol, XLogP of -0.51, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonan-2-yl)-2-oxoethyl]-N-methylmethanesulfonamide is sourced from PubChem (CID 56765694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).