About N-but-3-ynyl-3,4-dimethylbenzamide
N-but-3-ynyl-3,4-dimethylbenzamide (PubChem CID 56765711) has the molecular formula C13H15NO
and a molecular weight of 201.27 g/mol. Its IUPAC name is N-but-3-ynyl-3,4-dimethylbenzamide.
Molecular Properties
| Compound Name | N-but-3-ynyl-3,4-dimethylbenzamide |
| PubChem CID | 56765711 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | N-but-3-ynyl-3,4-dimethylbenzamide |
| SMILES | C#CCCNC(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C13H15NO/c1-4-5-8-14-13(15)12-7-6-10(2)11(3)9-12/h1,6-7,9H,5,8H2,2-3H3,(H,14,15) |
| InChIKey | WDKULNPHBJQNOL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-but-3-ynyl-3,4-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-3-ynyl-3,4-dimethylbenzamide?
The IUPAC name of N-but-3-ynyl-3,4-dimethylbenzamide (CID 56765711) is N-but-3-ynyl-3,4-dimethylbenzamide.
What is the SMILES notation for N-but-3-ynyl-3,4-dimethylbenzamide?
The canonical SMILES for N-but-3-ynyl-3,4-dimethylbenzamide is C#CCCNC(=O)c1ccc(C)c(C)c1.
What is the InChIKey of N-but-3-ynyl-3,4-dimethylbenzamide?
The InChIKey is WDKULNPHBJQNOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO/c1-4-5-8-14-13(15)12-7-6-10(2)11(3)9-12/h1,6-7,9H,5,8H2,2-3H3,(H,14,15).
What are the key properties of N-but-3-ynyl-3,4-dimethylbenzamide?
N-but-3-ynyl-3,4-dimethylbenzamide has a molecular weight of 201.27 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-3-ynyl-3,4-dimethylbenzamide is sourced from PubChem (CID 56765711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).