C11H13NO2 — CID 56766062
4-methyl-1,2,3,4-tetrahydroquinoline-8-carboxylic acid (PubChem CID 56766062) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 4-methyl-1,2,3,4-tetrahydroquinoline-8-carboxylic acid.
| Compound Name | 4-methyl-1,2,3,4-tetrahydroquinoline-8-carboxylic acid |
|---|---|
| PubChem CID | 56766062 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 4-methyl-1,2,3,4-tetrahydroquinoline-8-carboxylic acid |
| SMILES | CC1CCNc2c(C(=O)O)cccc21 |
| InChI | InChI=1S/C11H13NO2/c1-7-5-6-12-10-8(7)3-2-4-9(10)11(13)14/h2-4,7,12H,5-6H2,1H3,(H,13,14) |
| InChIKey | YPHSTQBSRIRNQJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |