About [3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]hydrazine
[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]hydrazine (PubChem CID 56766834) has the molecular formula C10H13N5O
and a molecular weight of 219.25 g/mol. Its IUPAC name is [3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]hydrazine.
Molecular Properties
| Compound Name | [3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]hydrazine |
| PubChem CID | 56766834 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | [3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]hydrazine |
| SMILES | CC(C)c1noc(-c2cccnc2NN)n1 |
| InChI | InChI=1S/C10H13N5O/c1-6(2)8-13-10(16-15-8)7-4-3-5-12-9(7)14-11/h3-6H,11H2,1-2H3,(H,12,14) |
| InChIKey | XCYDMCVFIZMPNE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]hydrazine?
The IUPAC name of [3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]hydrazine (CID 56766834) is [3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]hydrazine.
What is the SMILES notation for [3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]hydrazine?
The canonical SMILES for [3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]hydrazine is CC(C)c1noc(-c2cccnc2NN)n1.
What is the InChIKey of [3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]hydrazine?
The InChIKey is XCYDMCVFIZMPNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5O/c1-6(2)8-13-10(16-15-8)7-4-3-5-12-9(7)14-11/h3-6H,11H2,1-2H3,(H,12,14).
What are the key properties of [3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]hydrazine?
[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]hydrazine has a molecular weight of 219.25 g/mol, XLogP of 1.54, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]hydrazine is sourced from PubChem (CID 56766834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).