C17H21FN4 — CID 56768235
[1-[2-(2-fluorophenyl)-6-methylpyrimidin-4-yl]piperidin-4-yl]methanamine (PubChem CID 56768235) has the molecular formula C17H21FN4 and a molecular weight of 300.38 g/mol. Its IUPAC name is [1-[2-(2-fluorophenyl)-6-methylpyrimidin-4-yl]piperidin-4-yl]methanamine.
| Compound Name | [1-[2-(2-fluorophenyl)-6-methylpyrimidin-4-yl]piperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 56768235 |
| Molecular Formula | C17H21FN4 |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | [1-[2-(2-fluorophenyl)-6-methylpyrimidin-4-yl]piperidin-4-yl]methanamine |
| SMILES | Cc1cc(N2CCC(CN)CC2)nc(-c2ccccc2F)n1 |
| InChI | InChI=1S/C17H21FN4/c1-12-10-16(22-8-6-13(11-19)7-9-22)21-17(20-12)14-4-2-3-5-15(14)18/h2-5,10,13H,6-9,11,19H2,1H3 |
| InChIKey | ZPKDPTAUTJZCES-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |