C15H11ClN4O2 — CID 56769041
1-[(3-chlorophenyl)methyl]-5-pyridin-4-yltriazole-4-carboxylic acid (PubChem CID 56769041) has the molecular formula C15H11ClN4O2 and a molecular weight of 314.73 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-5-pyridin-4-yltriazole-4-carboxylic acid.
| Compound Name | 1-[(3-chlorophenyl)methyl]-5-pyridin-4-yltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 56769041 |
| Molecular Formula | C15H11ClN4O2 |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-5-pyridin-4-yltriazole-4-carboxylic acid |
| SMILES | O=C(O)c1nnn(Cc2cccc(Cl)c2)c1-c1ccncc1 |
| InChI | InChI=1S/C15H11ClN4O2/c16-12-3-1-2-10(8-12)9-20-14(11-4-6-17-7-5-11)13(15(21)22)18-19-20/h1-8H,9H2,(H,21,22) |
| InChIKey | XJEXBGIWCZWGSD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |