C17H13BrFN3O2 — CID 56769183
1-[(4-bromo-2-fluorophenyl)methyl]-5-(4-methylphenyl)triazole-4-carboxylic acid (PubChem CID 56769183) has the molecular formula C17H13BrFN3O2 and a molecular weight of 390.21 g/mol. Its IUPAC name is 1-[(4-bromo-2-fluorophenyl)methyl]-5-(4-methylphenyl)triazole-4-carboxylic acid.
| Compound Name | 1-[(4-bromo-2-fluorophenyl)methyl]-5-(4-methylphenyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 56769183 |
| Molecular Formula | C17H13BrFN3O2 |
| Molecular Weight | 390.21 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 1-[(4-bromo-2-fluorophenyl)methyl]-5-(4-methylphenyl)triazole-4-carboxylic acid |
| SMILES | Cc1ccc(-c2c(C(=O)O)nnn2Cc2ccc(Br)cc2F)cc1 |
| InChI | InChI=1S/C17H13BrFN3O2/c1-10-2-4-11(5-3-10)16-15(17(23)24)20-21-22(16)9-12-6-7-13(18)8-14(12)19/h2-8H,9H2,1H3,(H,23,24) |
| InChIKey | ZKCSHUXULOOICL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.21 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |