About [1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-methoxyphenyl)triazol-4-yl]methanol
[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-methoxyphenyl)triazol-4-yl]methanol (PubChem CID 56769361) has the molecular formula C18H17N3O4
and a molecular weight of 339.35 g/mol. Its IUPAC name is [1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-methoxyphenyl)triazol-4-yl]methanol.
Molecular Properties
| Compound Name | [1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-methoxyphenyl)triazol-4-yl]methanol |
| PubChem CID | 56769361 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | [1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-methoxyphenyl)triazol-4-yl]methanol |
| SMILES | COc1cccc(-c2c(CO)nnn2-c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C18H17N3O4/c1-23-14-4-2-3-12(9-14)18-15(11-22)19-20-21(18)13-5-6-16-17(10-13)25-8-7-24-16/h2-6,9-10,22H,7-8,11H2,1H3 |
| InChIKey | XXBPJLAZKJGZEH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-methoxyphenyl)triazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-methoxyphenyl)triazol-4-yl]methanol?
The IUPAC name of [1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-methoxyphenyl)triazol-4-yl]methanol (CID 56769361) is [1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-methoxyphenyl)triazol-4-yl]methanol.
What is the SMILES notation for [1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-methoxyphenyl)triazol-4-yl]methanol?
The canonical SMILES for [1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-methoxyphenyl)triazol-4-yl]methanol is COc1cccc(-c2c(CO)nnn2-c2ccc3c(c2)OCCO3)c1.
What is the InChIKey of [1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-methoxyphenyl)triazol-4-yl]methanol?
The InChIKey is XXBPJLAZKJGZEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O4/c1-23-14-4-2-3-12(9-14)18-15(11-22)19-20-21(18)13-5-6-16-17(10-13)25-8-7-24-16/h2-6,9-10,22H,7-8,11H2,1H3.
What are the key properties of [1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-methoxyphenyl)triazol-4-yl]methanol?
[1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-methoxyphenyl)triazol-4-yl]methanol has a molecular weight of 339.35 g/mol, XLogP of 2.21, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(3-methoxyphenyl)triazol-4-yl]methanol is sourced from PubChem (CID 56769361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).