About [5-(3-chlorophenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-4-yl]methanol
[5-(3-chlorophenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-4-yl]methanol (PubChem CID 56769403) has the molecular formula C17H14ClN3O3
and a molecular weight of 343.77 g/mol. Its IUPAC name is [5-(3-chlorophenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-4-yl]methanol.
Molecular Properties
| Compound Name | [5-(3-chlorophenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-4-yl]methanol |
| PubChem CID | 56769403 |
| Molecular Formula | C17H14ClN3O3 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | [5-(3-chlorophenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-4-yl]methanol |
| SMILES | OCc1nnn(-c2ccc3c(c2)OCCO3)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H14ClN3O3/c18-12-3-1-2-11(8-12)17-14(10-22)19-20-21(17)13-4-5-15-16(9-13)24-7-6-23-15/h1-5,8-9,22H,6-7,10H2 |
| InChIKey | ISCZBDICCAAPSX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-(3-chlorophenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3-chlorophenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-4-yl]methanol?
The IUPAC name of [5-(3-chlorophenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-4-yl]methanol (CID 56769403) is [5-(3-chlorophenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-4-yl]methanol.
What is the SMILES notation for [5-(3-chlorophenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-4-yl]methanol?
The canonical SMILES for [5-(3-chlorophenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-4-yl]methanol is OCc1nnn(-c2ccc3c(c2)OCCO3)c1-c1cccc(Cl)c1.
What is the InChIKey of [5-(3-chlorophenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-4-yl]methanol?
The InChIKey is ISCZBDICCAAPSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClN3O3/c18-12-3-1-2-11(8-12)17-14(10-22)19-20-21(17)13-4-5-15-16(9-13)24-7-6-23-15/h1-5,8-9,22H,6-7,10H2.
What are the key properties of [5-(3-chlorophenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-4-yl]methanol?
[5-(3-chlorophenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-4-yl]methanol has a molecular weight of 343.77 g/mol, XLogP of 2.85, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3-chlorophenyl)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazol-4-yl]methanol is sourced from PubChem (CID 56769403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).