About 1-[5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]pyrrolidin-3-amine
1-[5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]pyrrolidin-3-amine (PubChem CID 56769891) has the molecular formula C16H16N6O
and a molecular weight of 308.34 g/mol. Its IUPAC name is 1-[5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]pyrrolidin-3-amine.
Molecular Properties
| Compound Name | 1-[5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]pyrrolidin-3-amine |
| PubChem CID | 56769891 |
| Molecular Formula | C16H16N6O |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-[5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]pyrrolidin-3-amine |
| SMILES | NC1CCN(c2ccc(-c3nc(-c4ccccn4)no3)cn2)C1 |
| InChI | InChI=1S/C16H16N6O/c17-12-6-8-22(10-12)14-5-4-11(9-19-14)16-20-15(21-23-16)13-3-1-2-7-18-13/h1-5,7,9,12H,6,8,10,17H2 |
| InChIKey | OGWBGFRCMYCUDX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]pyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]pyrrolidin-3-amine?
The IUPAC name of 1-[5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]pyrrolidin-3-amine (CID 56769891) is 1-[5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]pyrrolidin-3-amine.
What is the SMILES notation for 1-[5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]pyrrolidin-3-amine?
The canonical SMILES for 1-[5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]pyrrolidin-3-amine is NC1CCN(c2ccc(-c3nc(-c4ccccn4)no3)cn2)C1.
What is the InChIKey of 1-[5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]pyrrolidin-3-amine?
The InChIKey is OGWBGFRCMYCUDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N6O/c17-12-6-8-22(10-12)14-5-4-11(9-19-14)16-20-15(21-23-16)13-3-1-2-7-18-13/h1-5,7,9,12H,6,8,10,17H2.
What are the key properties of 1-[5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]pyrrolidin-3-amine?
1-[5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]pyrrolidin-3-amine has a molecular weight of 308.34 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]pyrrolidin-3-amine is sourced from PubChem (CID 56769891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).