About 1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]piperidin-3-amine
1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]piperidin-3-amine (PubChem CID 56770081) has the molecular formula C13H17N5O
and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]piperidin-3-amine.
Molecular Properties
| Compound Name | 1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]piperidin-3-amine |
| PubChem CID | 56770081 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]piperidin-3-amine |
| SMILES | Cc1noc(-c2ccnc(N3CCCC(N)C3)c2)n1 |
| InChI | InChI=1S/C13H17N5O/c1-9-16-13(19-17-9)10-4-5-15-12(7-10)18-6-2-3-11(14)8-18/h4-5,7,11H,2-3,6,8,14H2,1H3 |
| InChIKey | ILBIUFRSKAEVAO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]piperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]piperidin-3-amine?
The IUPAC name of 1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]piperidin-3-amine (CID 56770081) is 1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]piperidin-3-amine.
What is the SMILES notation for 1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]piperidin-3-amine?
The canonical SMILES for 1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]piperidin-3-amine is Cc1noc(-c2ccnc(N3CCCC(N)C3)c2)n1.
What is the InChIKey of 1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]piperidin-3-amine?
The InChIKey is ILBIUFRSKAEVAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N5O/c1-9-16-13(19-17-9)10-4-5-15-12(7-10)18-6-2-3-11(14)8-18/h4-5,7,11H,2-3,6,8,14H2,1H3.
What are the key properties of 1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]piperidin-3-amine?
1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]piperidin-3-amine has a molecular weight of 259.31 g/mol, XLogP of 1.37, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]piperidin-3-amine is sourced from PubChem (CID 56770081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).