C17H22N4 — CID 56770685
1-[6-(2,5-dimethylphenyl)pyridazin-3-yl]-1,4-diazepane (PubChem CID 56770685) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-[6-(2,5-dimethylphenyl)pyridazin-3-yl]-1,4-diazepane.
| Compound Name | 1-[6-(2,5-dimethylphenyl)pyridazin-3-yl]-1,4-diazepane |
|---|---|
| PubChem CID | 56770685 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 1-[6-(2,5-dimethylphenyl)pyridazin-3-yl]-1,4-diazepane |
| SMILES | Cc1ccc(C)c(-c2ccc(N3CCCNCC3)nn2)c1 |
| InChI | InChI=1S/C17H22N4/c1-13-4-5-14(2)15(12-13)16-6-7-17(20-19-16)21-10-3-8-18-9-11-21/h4-7,12,18H,3,8-11H2,1-2H3 |
| InChIKey | GQACYYDZOMIRDN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |