About methyl 1-[2-(3,5-difluorophenyl)-2-oxoethyl]triazole-4-carboxylate
methyl 1-[2-(3,5-difluorophenyl)-2-oxoethyl]triazole-4-carboxylate (PubChem CID 56771333) has the molecular formula C12H9F2N3O3
and a molecular weight of 281.22 g/mol. Its IUPAC name is methyl 1-[2-(3,5-difluorophenyl)-2-oxoethyl]triazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[2-(3,5-difluorophenyl)-2-oxoethyl]triazole-4-carboxylate |
| PubChem CID | 56771333 |
| Molecular Formula | C12H9F2N3O3 |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | methyl 1-[2-(3,5-difluorophenyl)-2-oxoethyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(CC(=O)c2cc(F)cc(F)c2)nn1 |
| InChI | InChI=1S/C12H9F2N3O3/c1-20-12(19)10-5-17(16-15-10)6-11(18)7-2-8(13)4-9(14)3-7/h2-5H,6H2,1H3 |
| InChIKey | VVVYIJYBBGPKFM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 1-[2-(3,5-difluorophenyl)-2-oxoethyl]triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[2-(3,5-difluorophenyl)-2-oxoethyl]triazole-4-carboxylate?
The IUPAC name of methyl 1-[2-(3,5-difluorophenyl)-2-oxoethyl]triazole-4-carboxylate (CID 56771333) is methyl 1-[2-(3,5-difluorophenyl)-2-oxoethyl]triazole-4-carboxylate.
What is the SMILES notation for methyl 1-[2-(3,5-difluorophenyl)-2-oxoethyl]triazole-4-carboxylate?
The canonical SMILES for methyl 1-[2-(3,5-difluorophenyl)-2-oxoethyl]triazole-4-carboxylate is COC(=O)c1cn(CC(=O)c2cc(F)cc(F)c2)nn1.
What is the InChIKey of methyl 1-[2-(3,5-difluorophenyl)-2-oxoethyl]triazole-4-carboxylate?
The InChIKey is VVVYIJYBBGPKFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F2N3O3/c1-20-12(19)10-5-17(16-15-10)6-11(18)7-2-8(13)4-9(14)3-7/h2-5H,6H2,1H3.
What are the key properties of methyl 1-[2-(3,5-difluorophenyl)-2-oxoethyl]triazole-4-carboxylate?
methyl 1-[2-(3,5-difluorophenyl)-2-oxoethyl]triazole-4-carboxylate has a molecular weight of 281.22 g/mol, XLogP of 1.23, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[2-(3,5-difluorophenyl)-2-oxoethyl]triazole-4-carboxylate is sourced from PubChem (CID 56771333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).