C20H19N3O4 — CID 56771826
2,4-dioxo-3-[(4-pyrrolidin-1-ylphenyl)methyl]-1H-quinazoline-7-carboxylic acid (PubChem CID 56771826) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is 2,4-dioxo-3-[(4-pyrrolidin-1-ylphenyl)methyl]-1H-quinazoline-7-carboxylic acid.
| Compound Name | 2,4-dioxo-3-[(4-pyrrolidin-1-ylphenyl)methyl]-1H-quinazoline-7-carboxylic acid |
|---|---|
| PubChem CID | 56771826 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2,4-dioxo-3-[(4-pyrrolidin-1-ylphenyl)methyl]-1H-quinazoline-7-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(=O)n(Cc3ccc(N4CCCC4)cc3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C20H19N3O4/c24-18-16-8-5-14(19(25)26)11-17(16)21-20(27)23(18)12-13-3-6-15(7-4-13)22-9-1-2-10-22/h3-8,11H,1-2,9-10,12H2,(H,21,27)(H,25,26) |
| InChIKey | FREKNMBOSQHGGE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|