C11H11F3N4S — CID 56772734
2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)aniline (PubChem CID 56772734) has the molecular formula C11H11F3N4S and a molecular weight of 288.30 g/mol. Its IUPAC name is 2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)aniline.
| Compound Name | 2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 56772734 |
| Molecular Formula | C11H11F3N4S |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)aniline |
| SMILES | CCc1nc(Sc2ccc(C(F)(F)F)cc2N)n[nH]1 |
| InChI | InChI=1S/C11H11F3N4S/c1-2-9-16-10(18-17-9)19-8-4-3-6(5-7(8)15)11(12,13)14/h3-5H,2,15H2,1H3,(H,16,17,18) |
| InChIKey | MDDAQAWSTAUBSM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|