C9H9N5OS — CID 56772874
5-amino-2-(1H-1,2,4-triazol-5-ylsulfanyl)benzamide (PubChem CID 56772874) has the molecular formula C9H9N5OS and a molecular weight of 235.27 g/mol. Its IUPAC name is 5-amino-2-(1H-1,2,4-triazol-5-ylsulfanyl)benzamide.
| Compound Name | 5-amino-2-(1H-1,2,4-triazol-5-ylsulfanyl)benzamide |
|---|---|
| PubChem CID | 56772874 |
| Molecular Formula | C9H9N5OS |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 5-amino-2-(1H-1,2,4-triazol-5-ylsulfanyl)benzamide |
| SMILES | NC(=O)c1cc(N)ccc1Sc1ncn[nH]1 |
| InChI | InChI=1S/C9H9N5OS/c10-5-1-2-7(6(3-5)8(11)15)16-9-12-4-13-14-9/h1-4H,10H2,(H2,11,15)(H,12,13,14) |
| InChIKey | OKJREIKPPFJUJY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|