About 2-(3,4-dichlorophenyl)-4,6-dimethyl-1H-benzimidazole
2-(3,4-dichlorophenyl)-4,6-dimethyl-1H-benzimidazole (PubChem CID 56773183) has the molecular formula C15H12Cl2N2
and a molecular weight of 291.18 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-4,6-dimethyl-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-(3,4-dichlorophenyl)-4,6-dimethyl-1H-benzimidazole |
| PubChem CID | 56773183 |
| Molecular Formula | C15H12Cl2N2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-4,6-dimethyl-1H-benzimidazole |
| SMILES | Cc1cc(C)c2nc(-c3ccc(Cl)c(Cl)c3)[nH]c2c1 |
| InChI | InChI=1S/C15H12Cl2N2/c1-8-5-9(2)14-13(6-8)18-15(19-14)10-3-4-11(16)12(17)7-10/h3-7H,1-2H3,(H,18,19) |
| InChIKey | IRIJWAWBUODBDR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3,4-dichlorophenyl)-4,6-dimethyl-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dichlorophenyl)-4,6-dimethyl-1H-benzimidazole?
The IUPAC name of 2-(3,4-dichlorophenyl)-4,6-dimethyl-1H-benzimidazole (CID 56773183) is 2-(3,4-dichlorophenyl)-4,6-dimethyl-1H-benzimidazole.
What is the SMILES notation for 2-(3,4-dichlorophenyl)-4,6-dimethyl-1H-benzimidazole?
The canonical SMILES for 2-(3,4-dichlorophenyl)-4,6-dimethyl-1H-benzimidazole is Cc1cc(C)c2nc(-c3ccc(Cl)c(Cl)c3)[nH]c2c1.
What is the InChIKey of 2-(3,4-dichlorophenyl)-4,6-dimethyl-1H-benzimidazole?
The InChIKey is IRIJWAWBUODBDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Cl2N2/c1-8-5-9(2)14-13(6-8)18-15(19-14)10-3-4-11(16)12(17)7-10/h3-7H,1-2H3,(H,18,19).
What are the key properties of 2-(3,4-dichlorophenyl)-4,6-dimethyl-1H-benzimidazole?
2-(3,4-dichlorophenyl)-4,6-dimethyl-1H-benzimidazole has a molecular weight of 291.18 g/mol, XLogP of 5.15, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dichlorophenyl)-4,6-dimethyl-1H-benzimidazole is sourced from PubChem (CID 56773183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).