C10H10F2N4 — CID 56773382
2-[3-(3,4-difluorophenyl)-1H-1,2,4-triazol-5-yl]ethanamine (PubChem CID 56773382) has the molecular formula C10H10F2N4 and a molecular weight of 224.21 g/mol. Its IUPAC name is 2-[3-(3,4-difluorophenyl)-1H-1,2,4-triazol-5-yl]ethanamine.
| Compound Name | 2-[3-(3,4-difluorophenyl)-1H-1,2,4-triazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 56773382 |
| Molecular Formula | C10H10F2N4 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 2-[3-(3,4-difluorophenyl)-1H-1,2,4-triazol-5-yl]ethanamine |
| SMILES | NCCc1nc(-c2ccc(F)c(F)c2)n[nH]1 |
| InChI | InChI=1S/C10H10F2N4/c11-7-2-1-6(5-8(7)12)10-14-9(3-4-13)15-16-10/h1-2,5H,3-4,13H2,(H,14,15,16) |
| InChIKey | DXKQBSXCRSCAIH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |