About 6-bromo-2,4-dichloro-5H-pyrrolo[3,2-d]pyrimidine
6-bromo-2,4-dichloro-5H-pyrrolo[3,2-d]pyrimidine (PubChem CID 56773433) has the molecular formula C6H2BrCl2N3
and a molecular weight of 266.91 g/mol. Its IUPAC name is 6-bromo-2,4-dichloro-5H-pyrrolo[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 6-bromo-2,4-dichloro-5H-pyrrolo[3,2-d]pyrimidine |
| PubChem CID | 56773433 |
| Molecular Formula | C6H2BrCl2N3 |
| Molecular Weight | 266.91 g/mol |
| Exact Mass | 264.88 |
| IUPAC Name | 6-bromo-2,4-dichloro-5H-pyrrolo[3,2-d]pyrimidine |
| SMILES | Clc1nc(Cl)c2[nH]c(Br)cc2n1 |
| InChI | InChI=1S/C6H2BrCl2N3/c7-3-1-2-4(11-3)5(8)12-6(9)10-2/h1,11H |
| InChIKey | REUJEODIDJCRTC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.91 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-2,4-dichloro-5H-pyrrolo[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2,4-dichloro-5H-pyrrolo[3,2-d]pyrimidine?
The IUPAC name of 6-bromo-2,4-dichloro-5H-pyrrolo[3,2-d]pyrimidine (CID 56773433) is 6-bromo-2,4-dichloro-5H-pyrrolo[3,2-d]pyrimidine.
What is the SMILES notation for 6-bromo-2,4-dichloro-5H-pyrrolo[3,2-d]pyrimidine?
The canonical SMILES for 6-bromo-2,4-dichloro-5H-pyrrolo[3,2-d]pyrimidine is Clc1nc(Cl)c2[nH]c(Br)cc2n1.
What is the InChIKey of 6-bromo-2,4-dichloro-5H-pyrrolo[3,2-d]pyrimidine?
The InChIKey is REUJEODIDJCRTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2BrCl2N3/c7-3-1-2-4(11-3)5(8)12-6(9)10-2/h1,11H.
What are the key properties of 6-bromo-2,4-dichloro-5H-pyrrolo[3,2-d]pyrimidine?
6-bromo-2,4-dichloro-5H-pyrrolo[3,2-d]pyrimidine has a molecular weight of 266.91 g/mol, XLogP of 3.03, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,4-dichloro-5H-pyrrolo[3,2-d]pyrimidine is sourced from PubChem (CID 56773433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).