About 6-bromo-2,4-dichlorothieno[3,2-d]pyrimidine
6-bromo-2,4-dichlorothieno[3,2-d]pyrimidine (PubChem CID 56773436) has the molecular formula C6HBrCl2N2S
and a molecular weight of 283.97 g/mol. Its IUPAC name is 6-bromo-2,4-dichlorothieno[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 6-bromo-2,4-dichlorothieno[3,2-d]pyrimidine |
| PubChem CID | 56773436 |
| Molecular Formula | C6HBrCl2N2S |
| Molecular Weight | 283.97 g/mol |
| Exact Mass | 281.84 |
| IUPAC Name | 6-bromo-2,4-dichlorothieno[3,2-d]pyrimidine |
| SMILES | Clc1nc(Cl)c2sc(Br)cc2n1 |
| InChI | InChI=1S/C6HBrCl2N2S/c7-3-1-2-4(12-3)5(8)11-6(9)10-2/h1H |
| InChIKey | JSIBZFQOVIDMRH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.97 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-2,4-dichlorothieno[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2,4-dichlorothieno[3,2-d]pyrimidine?
The IUPAC name of 6-bromo-2,4-dichlorothieno[3,2-d]pyrimidine (CID 56773436) is 6-bromo-2,4-dichlorothieno[3,2-d]pyrimidine.
What is the SMILES notation for 6-bromo-2,4-dichlorothieno[3,2-d]pyrimidine?
The canonical SMILES for 6-bromo-2,4-dichlorothieno[3,2-d]pyrimidine is Clc1nc(Cl)c2sc(Br)cc2n1.
What is the InChIKey of 6-bromo-2,4-dichlorothieno[3,2-d]pyrimidine?
The InChIKey is JSIBZFQOVIDMRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6HBrCl2N2S/c7-3-1-2-4(12-3)5(8)11-6(9)10-2/h1H.
What are the key properties of 6-bromo-2,4-dichlorothieno[3,2-d]pyrimidine?
6-bromo-2,4-dichlorothieno[3,2-d]pyrimidine has a molecular weight of 283.97 g/mol, XLogP of 3.76, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,4-dichlorothieno[3,2-d]pyrimidine is sourced from PubChem (CID 56773436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).