About 4-piperazin-1-ylthiane 1,1-dioxide;dihydrochloride
4-piperazin-1-ylthiane 1,1-dioxide;dihydrochloride (PubChem CID 56773490) has the molecular formula C9H20Cl2N2O2S
and a molecular weight of 291.24 g/mol. Its IUPAC name is 4-piperazin-1-ylthiane 1,1-dioxide;dihydrochloride.
Molecular Properties
| Compound Name | 4-piperazin-1-ylthiane 1,1-dioxide;dihydrochloride |
| PubChem CID | 56773490 |
| Molecular Formula | C9H20Cl2N2O2S |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 4-piperazin-1-ylthiane 1,1-dioxide;dihydrochloride |
| SMILES | Cl.Cl.O=S1(=O)CCC(N2CCNCC2)CC1 |
| InChI | InChI=1S/C9H18N2O2S.2ClH/c12-14(13)7-1-9(2-8-14)11-5-3-10-4-6-11;;/h9-10H,1-8H2;2*1H |
| InChIKey | IDXMINCFYOKNTR-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-piperazin-1-ylthiane 1,1-dioxide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperazin-1-ylthiane 1,1-dioxide;dihydrochloride?
The IUPAC name of 4-piperazin-1-ylthiane 1,1-dioxide;dihydrochloride (CID 56773490) is 4-piperazin-1-ylthiane 1,1-dioxide;dihydrochloride.
What is the SMILES notation for 4-piperazin-1-ylthiane 1,1-dioxide;dihydrochloride?
The canonical SMILES for 4-piperazin-1-ylthiane 1,1-dioxide;dihydrochloride is Cl.Cl.O=S1(=O)CCC(N2CCNCC2)CC1.
What is the InChIKey of 4-piperazin-1-ylthiane 1,1-dioxide;dihydrochloride?
The InChIKey is IDXMINCFYOKNTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2S.2ClH/c12-14(13)7-1-9(2-8-14)11-5-3-10-4-6-11;;/h9-10H,1-8H2;2*1H.
What are the key properties of 4-piperazin-1-ylthiane 1,1-dioxide;dihydrochloride?
4-piperazin-1-ylthiane 1,1-dioxide;dihydrochloride has a molecular weight of 291.24 g/mol, XLogP of 0.31, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperazin-1-ylthiane 1,1-dioxide;dihydrochloride is sourced from PubChem (CID 56773490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).