About (5-cyclopropyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride
(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride (PubChem CID 56773494) has the molecular formula C6H10ClN3O
and a molecular weight of 175.62 g/mol. Its IUPAC name is (5-cyclopropyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (5-cyclopropyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride |
| PubChem CID | 56773494 |
| Molecular Formula | C6H10ClN3O |
| Molecular Weight | 175.62 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | (5-cyclopropyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride |
| SMILES | Cl.NCc1noc(C2CC2)n1 |
| InChI | InChI=1S/C6H9N3O.ClH/c7-3-5-8-6(10-9-5)4-1-2-4;/h4H,1-3,7H2;1H |
| InChIKey | KBQVOEOUNQLWAT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.62 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-cyclopropyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-cyclopropyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride?
The IUPAC name of (5-cyclopropyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride (CID 56773494) is (5-cyclopropyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride.
What is the SMILES notation for (5-cyclopropyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride?
The canonical SMILES for (5-cyclopropyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride is Cl.NCc1noc(C2CC2)n1.
What is the InChIKey of (5-cyclopropyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride?
The InChIKey is KBQVOEOUNQLWAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O.ClH/c7-3-5-8-6(10-9-5)4-1-2-4;/h4H,1-3,7H2;1H.
What are the key properties of (5-cyclopropyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride?
(5-cyclopropyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride has a molecular weight of 175.62 g/mol, XLogP of 0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyclopropyl-1,2,4-oxadiazol-3-yl)methanamine;hydrochloride is sourced from PubChem (CID 56773494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).