About 3-amino-7-chloro-1,3-dihydroindol-2-one;hydrochloride
3-amino-7-chloro-1,3-dihydroindol-2-one;hydrochloride (PubChem CID 56773583) has the molecular formula C8H8Cl2N2O
and a molecular weight of 219.07 g/mol. Its IUPAC name is 3-amino-7-chloro-1,3-dihydroindol-2-one;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-7-chloro-1,3-dihydroindol-2-one;hydrochloride |
| PubChem CID | 56773583 |
| Molecular Formula | C8H8Cl2N2O |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 3-amino-7-chloro-1,3-dihydroindol-2-one;hydrochloride |
| SMILES | Cl.NC1C(=O)Nc2c(Cl)cccc21 |
| InChI | InChI=1S/C8H7ClN2O.ClH/c9-5-3-1-2-4-6(10)8(12)11-7(4)5;/h1-3,6H,10H2,(H,11,12);1H |
| InChIKey | DHQZTWWGLTVEDY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-7-chloro-1,3-dihydroindol-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-7-chloro-1,3-dihydroindol-2-one;hydrochloride?
The IUPAC name of 3-amino-7-chloro-1,3-dihydroindol-2-one;hydrochloride (CID 56773583) is 3-amino-7-chloro-1,3-dihydroindol-2-one;hydrochloride.
What is the SMILES notation for 3-amino-7-chloro-1,3-dihydroindol-2-one;hydrochloride?
The canonical SMILES for 3-amino-7-chloro-1,3-dihydroindol-2-one;hydrochloride is Cl.NC1C(=O)Nc2c(Cl)cccc21.
What is the InChIKey of 3-amino-7-chloro-1,3-dihydroindol-2-one;hydrochloride?
The InChIKey is DHQZTWWGLTVEDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN2O.ClH/c9-5-3-1-2-4-6(10)8(12)11-7(4)5;/h1-3,6H,10H2,(H,11,12);1H.
What are the key properties of 3-amino-7-chloro-1,3-dihydroindol-2-one;hydrochloride?
3-amino-7-chloro-1,3-dihydroindol-2-one;hydrochloride has a molecular weight of 219.07 g/mol, XLogP of 1.71, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-7-chloro-1,3-dihydroindol-2-one;hydrochloride is sourced from PubChem (CID 56773583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).