About 3-[(5-methyl-1,3-thiazol-2-yl)methylamino]propan-1-ol;dihydrochloride
3-[(5-methyl-1,3-thiazol-2-yl)methylamino]propan-1-ol;dihydrochloride (PubChem CID 56773662) has the molecular formula C8H16Cl2N2OS
and a molecular weight of 259.20 g/mol. Its IUPAC name is 3-[(5-methyl-1,3-thiazol-2-yl)methylamino]propan-1-ol;dihydrochloride.
Molecular Properties
| Compound Name | 3-[(5-methyl-1,3-thiazol-2-yl)methylamino]propan-1-ol;dihydrochloride |
| PubChem CID | 56773662 |
| Molecular Formula | C8H16Cl2N2OS |
| Molecular Weight | 259.20 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 3-[(5-methyl-1,3-thiazol-2-yl)methylamino]propan-1-ol;dihydrochloride |
| SMILES | Cc1cnc(CNCCCO)s1.Cl.Cl |
| InChI | InChI=1S/C8H14N2OS.2ClH/c1-7-5-10-8(12-7)6-9-3-2-4-11;;/h5,9,11H,2-4,6H2,1H3;2*1H |
| InChIKey | HLBJEDLVFSZNSK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.20 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-methyl-1,3-thiazol-2-yl)methylamino]propan-1-ol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-methyl-1,3-thiazol-2-yl)methylamino]propan-1-ol;dihydrochloride?
The IUPAC name of 3-[(5-methyl-1,3-thiazol-2-yl)methylamino]propan-1-ol;dihydrochloride (CID 56773662) is 3-[(5-methyl-1,3-thiazol-2-yl)methylamino]propan-1-ol;dihydrochloride.
What is the SMILES notation for 3-[(5-methyl-1,3-thiazol-2-yl)methylamino]propan-1-ol;dihydrochloride?
The canonical SMILES for 3-[(5-methyl-1,3-thiazol-2-yl)methylamino]propan-1-ol;dihydrochloride is Cc1cnc(CNCCCO)s1.Cl.Cl.
What is the InChIKey of 3-[(5-methyl-1,3-thiazol-2-yl)methylamino]propan-1-ol;dihydrochloride?
The InChIKey is HLBJEDLVFSZNSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2OS.2ClH/c1-7-5-10-8(12-7)6-9-3-2-4-11;;/h5,9,11H,2-4,6H2,1H3;2*1H.
What are the key properties of 3-[(5-methyl-1,3-thiazol-2-yl)methylamino]propan-1-ol;dihydrochloride?
3-[(5-methyl-1,3-thiazol-2-yl)methylamino]propan-1-ol;dihydrochloride has a molecular weight of 259.20 g/mol, XLogP of 1.77, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-methyl-1,3-thiazol-2-yl)methylamino]propan-1-ol;dihydrochloride is sourced from PubChem (CID 56773662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).