C18H30O4 — CID 56773932
methyl (2E,4E,8E)-7,13-dihydroxy-4,8,12-trimethyltetradeca-2,4,8-trienoate (PubChem CID 56773932) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is methyl (2E,4E,8E)-7,13-dihydroxy-4,8,12-trimethyltetradeca-2,4,8-trienoate.
| Compound Name | methyl (2E,4E,8E)-7,13-dihydroxy-4,8,12-trimethyltetradeca-2,4,8-trienoate |
|---|---|
| PubChem CID | 56773932 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | methyl (2E,4E,8E)-7,13-dihydroxy-4,8,12-trimethyltetradeca-2,4,8-trienoate |
| SMILES | COC(=O)/C=C/C(C)=C/CC(O)/C(C)=C/CCC(C)C(C)O |
| InChI | InChI=1S/C18H30O4/c1-13(10-12-18(21)22-5)9-11-17(20)15(3)8-6-7-14(2)16(4)19/h8-10,12,14,16-17,19-20H,6-7,11H2,1-5H3/b12-10+,13-9+,15-8+ |
| InChIKey | NLZZWSRYPUGPEO-QUYVSBDASA-N |
| XLogP | 3.16 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|