C15H20N4O4 — CID 56774431
1-[[(4S)-1-cyclohexyl-2,5-dioxoimidazolidin-4-yl]methyl]-5-methylpyrimidine-2,4-dione (PubChem CID 56774431) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is 1-[[(4S)-1-cyclohexyl-2,5-dioxoimidazolidin-4-yl]methyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[[(4S)-1-cyclohexyl-2,5-dioxoimidazolidin-4-yl]methyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 56774431 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-[[(4S)-1-cyclohexyl-2,5-dioxoimidazolidin-4-yl]methyl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(C[C@@H]2NC(=O)N(C3CCCCC3)C2=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H20N4O4/c1-9-7-18(14(22)17-12(9)20)8-11-13(21)19(15(23)16-11)10-5-3-2-4-6-10/h7,10-11H,2-6,8H2,1H3,(H,16,23)(H,17,20,22)/t11-/m0/s1 |
| InChIKey | BSNPHGYOYUCFQN-NSHDSACASA-N |
| XLogP | 0.10 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|