About (2S)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(hexanoylamino)propanoic acid
(2S)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(hexanoylamino)propanoic acid (PubChem CID 56774495) has the molecular formula C13H18FN3O5
and a molecular weight of 315.30 g/mol. Its IUPAC name is (2S)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(hexanoylamino)propanoic acid.
Molecular Properties
| Compound Name | (2S)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(hexanoylamino)propanoic acid |
| PubChem CID | 56774495 |
| Molecular Formula | C13H18FN3O5 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | (2S)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(hexanoylamino)propanoic acid |
| SMILES | CCCCCC(=O)N[C@@H](Cn1cc(F)c(=O)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C13H18FN3O5/c1-2-3-4-5-10(18)15-9(12(20)21)7-17-6-8(14)11(19)16-13(17)22/h6,9H,2-5,7H2,1H3,(H,15,18)(H,20,21)(H,16,19,22)/t9-/m0/s1 |
| InChIKey | PHCLTSUSSPSPOA-VIFPVBQESA-N |
| XLogP | -0.17 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(hexanoylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(hexanoylamino)propanoic acid?
The IUPAC name of (2S)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(hexanoylamino)propanoic acid (CID 56774495) is (2S)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(hexanoylamino)propanoic acid.
What is the SMILES notation for (2S)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(hexanoylamino)propanoic acid?
The canonical SMILES for (2S)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(hexanoylamino)propanoic acid is CCCCCC(=O)N[C@@H](Cn1cc(F)c(=O)[nH]c1=O)C(=O)O.
What is the InChIKey of (2S)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(hexanoylamino)propanoic acid?
The InChIKey is PHCLTSUSSPSPOA-VIFPVBQESA-N. The full InChI is InChI=1S/C13H18FN3O5/c1-2-3-4-5-10(18)15-9(12(20)21)7-17-6-8(14)11(19)16-13(17)22/h6,9H,2-5,7H2,1H3,(H,15,18)(H,20,21)(H,16,19,22)/t9-/m0/s1.
What are the key properties of (2S)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(hexanoylamino)propanoic acid?
(2S)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(hexanoylamino)propanoic acid has a molecular weight of 315.30 g/mol, XLogP of -0.17, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2-(hexanoylamino)propanoic acid is sourced from PubChem (CID 56774495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).