C13H19N3O5 — CID 56774522
(2S)-3-(2,4-dioxopyrimidin-1-yl)-2-(hexanoylamino)propanoic acid (PubChem CID 56774522) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-(hexanoylamino)propanoic acid.
| Compound Name | (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-(hexanoylamino)propanoic acid |
|---|---|
| PubChem CID | 56774522 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-(hexanoylamino)propanoic acid |
| SMILES | CCCCCC(=O)N[C@@H](Cn1ccc(=O)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C13H19N3O5/c1-2-3-4-5-10(17)14-9(12(19)20)8-16-7-6-11(18)15-13(16)21/h6-7,9H,2-5,8H2,1H3,(H,14,17)(H,19,20)(H,15,18,21)/t9-/m0/s1 |
| InChIKey | YNGHHKZISYCPRH-VIFPVBQESA-N |
| XLogP | -0.31 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|