About (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-[(2-methoxyacetyl)amino]propanoic acid
(2S)-3-(2,4-dioxopyrimidin-1-yl)-2-[(2-methoxyacetyl)amino]propanoic acid (PubChem CID 56774526) has the molecular formula C10H13N3O6
and a molecular weight of 271.23 g/mol. Its IUPAC name is (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-[(2-methoxyacetyl)amino]propanoic acid.
Molecular Properties
| Compound Name | (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-[(2-methoxyacetyl)amino]propanoic acid |
| PubChem CID | 56774526 |
| Molecular Formula | C10H13N3O6 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-[(2-methoxyacetyl)amino]propanoic acid |
| SMILES | COCC(=O)N[C@@H](Cn1ccc(=O)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C10H13N3O6/c1-19-5-8(15)11-6(9(16)17)4-13-3-2-7(14)12-10(13)18/h2-3,6H,4-5H2,1H3,(H,11,15)(H,16,17)(H,12,14,18)/t6-/m0/s1 |
| InChIKey | YIGPGCQMOLTTAO-LURJTMIESA-N |
| XLogP | -2.25 |
| TPSA | 130.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-[(2-methoxyacetyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-[(2-methoxyacetyl)amino]propanoic acid?
The IUPAC name of (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-[(2-methoxyacetyl)amino]propanoic acid (CID 56774526) is (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-[(2-methoxyacetyl)amino]propanoic acid.
What is the SMILES notation for (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-[(2-methoxyacetyl)amino]propanoic acid?
The canonical SMILES for (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-[(2-methoxyacetyl)amino]propanoic acid is COCC(=O)N[C@@H](Cn1ccc(=O)[nH]c1=O)C(=O)O.
What is the InChIKey of (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-[(2-methoxyacetyl)amino]propanoic acid?
The InChIKey is YIGPGCQMOLTTAO-LURJTMIESA-N. The full InChI is InChI=1S/C10H13N3O6/c1-19-5-8(15)11-6(9(16)17)4-13-3-2-7(14)12-10(13)18/h2-3,6H,4-5H2,1H3,(H,11,15)(H,16,17)(H,12,14,18)/t6-/m0/s1.
What are the key properties of (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-[(2-methoxyacetyl)amino]propanoic acid?
(2S)-3-(2,4-dioxopyrimidin-1-yl)-2-[(2-methoxyacetyl)amino]propanoic acid has a molecular weight of 271.23 g/mol, XLogP of -2.25, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-[(2-methoxyacetyl)amino]propanoic acid is sourced from PubChem (CID 56774526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).