(2S)-3-(2,4-dioxopyrimidin-1-yl)-2-(propylamino)propanoic acid

C10H15N3O4 — CID 56774537

IUPAC(2S)-3-(2,4-dioxopyrimidin-1-yl)-2-(propylamino)propanoic acid
SMILESCCCN[C@@H](Cn1ccc(=O)[nH]c1=O)C(=O)O
InChIInChI=1S/C10H15N3O4/c1-2-4-11-7(9(15)16)6-13-5-3-8(14)12-10(13)17/h3,5,7,11H,2,4,6H2,1H3,(H,15,16)(H,12,14,17)/t7-/m0/s1
InChIKeySWHWKHHSNPJKNE-ZETCQYMHSA-N
MW241.25 g/mol
LogP-1.01
Rot. Bonds6

About (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-(propylamino)propanoic acid

(2S)-3-(2,4-dioxopyrimidin-1-yl)-2-(propylamino)propanoic acid (PubChem CID 56774537) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-(propylamino)propanoic acid.

Molecular Properties

Compound Name(2S)-3-(2,4-dioxopyrimidin-1-yl)-2-(propylamino)propanoic acid
PubChem CID56774537
Molecular FormulaC10H15N3O4
Molecular Weight241.25 g/mol
Exact Mass241.11
IUPAC Name(2S)-3-(2,4-dioxopyrimidin-1-yl)-2-(propylamino)propanoic acid
SMILESCCCN[C@@H](Cn1ccc(=O)[nH]c1=O)C(=O)O
InChIInChI=1S/C10H15N3O4/c1-2-4-11-7(9(15)16)6-13-5-3-8(14)12-10(13)17/h3,5,7,11H,2,4,6H2,1H3,(H,15,16)(H,12,14,17)/t7-/m0/s1
InChIKeySWHWKHHSNPJKNE-ZETCQYMHSA-N
XLogP-1.01
TPSA104.19 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.25
LogP ≤ 5-1.01
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-(propylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-(propylamino)propanoic acid?
The IUPAC name of (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-(propylamino)propanoic acid (CID 56774537) is (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-(propylamino)propanoic acid.
What is the SMILES notation for (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-(propylamino)propanoic acid?
The canonical SMILES for (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-(propylamino)propanoic acid is CCCN[C@@H](Cn1ccc(=O)[nH]c1=O)C(=O)O.
What is the InChIKey of (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-(propylamino)propanoic acid?
The InChIKey is SWHWKHHSNPJKNE-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H15N3O4/c1-2-4-11-7(9(15)16)6-13-5-3-8(14)12-10(13)17/h3,5,7,11H,2,4,6H2,1H3,(H,15,16)(H,12,14,17)/t7-/m0/s1.
What are the key properties of (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-(propylamino)propanoic acid?
(2S)-3-(2,4-dioxopyrimidin-1-yl)-2-(propylamino)propanoic acid has a molecular weight of 241.25 g/mol, XLogP of -1.01, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-(2,4-dioxopyrimidin-1-yl)-2-(propylamino)propanoic acid is sourced from PubChem (CID 56774537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).