C17H22N2O4 — CID 56774899
N-[4-[(R)-hydroxy-[(3R)-4-methyl-5-oxomorpholin-3-yl]methyl]phenyl]cyclobutanecarboxamide (PubChem CID 56774899) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is N-[4-[(R)-hydroxy-[(3R)-4-methyl-5-oxomorpholin-3-yl]methyl]phenyl]cyclobutanecarboxamide.
| Compound Name | N-[4-[(R)-hydroxy-[(3R)-4-methyl-5-oxomorpholin-3-yl]methyl]phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 56774899 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N-[4-[(R)-hydroxy-[(3R)-4-methyl-5-oxomorpholin-3-yl]methyl]phenyl]cyclobutanecarboxamide |
| SMILES | CN1C(=O)COC[C@@H]1[C@H](O)c1ccc(NC(=O)C2CCC2)cc1 |
| InChI | InChI=1S/C17H22N2O4/c1-19-14(9-23-10-15(19)20)16(21)11-5-7-13(8-6-11)18-17(22)12-3-2-4-12/h5-8,12,14,16,21H,2-4,9-10H2,1H3,(H,18,22)/t14-,16-/m1/s1 |
| InChIKey | GDMXXJMGWAUBLD-GDBMZVCRSA-N |
| XLogP | 1.32 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |