C17H22N2O3 — CID 56774976
(4aR,7aS)-6-(oxan-4-yl)-4-phenyl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one (PubChem CID 56774976) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is (4aR,7aS)-6-(oxan-4-yl)-4-phenyl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one.
| Compound Name | (4aR,7aS)-6-(oxan-4-yl)-4-phenyl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 56774976 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (4aR,7aS)-6-(oxan-4-yl)-4-phenyl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one |
| SMILES | O=C1CO[C@H]2CN(C3CCOCC3)C[C@H]2N1c1ccccc1 |
| InChI | InChI=1S/C17H22N2O3/c20-17-12-22-16-11-18(13-6-8-21-9-7-13)10-15(16)19(17)14-4-2-1-3-5-14/h1-5,13,15-16H,6-12H2/t15-,16+/m1/s1 |
| InChIKey | GHGCHIIKLGYTSF-CVEARBPZSA-N |
| XLogP | 1.28 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |