C20H21N3O4 — CID 56775017
4-[[(4aR,7aS)-3-oxo-4-(pyridin-3-ylmethyl)-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-6-yl]methyl]benzoic acid (PubChem CID 56775017) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 4-[[(4aR,7aS)-3-oxo-4-(pyridin-3-ylmethyl)-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-6-yl]methyl]benzoic acid.
| Compound Name | 4-[[(4aR,7aS)-3-oxo-4-(pyridin-3-ylmethyl)-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-6-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 56775017 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 4-[[(4aR,7aS)-3-oxo-4-(pyridin-3-ylmethyl)-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-6-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN2C[C@@H]3OCC(=O)N(Cc4cccnc4)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C20H21N3O4/c24-19-13-27-18-12-22(9-14-3-5-16(6-4-14)20(25)26)11-17(18)23(19)10-15-2-1-7-21-8-15/h1-8,17-18H,9-13H2,(H,25,26)/t17-,18+/m1/s1 |
| InChIKey | ZSSCTXFANCBQTA-MSOLQXFVSA-N |
| XLogP | 1.39 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |