C21H21F3N2O2 — CID 56775129
(4aR,7aS)-6-benzyl-4-[[3-(trifluoromethyl)phenyl]methyl]-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one (PubChem CID 56775129) has the molecular formula C21H21F3N2O2 and a molecular weight of 390.41 g/mol. Its IUPAC name is (4aR,7aS)-6-benzyl-4-[[3-(trifluoromethyl)phenyl]methyl]-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one.
| Compound Name | (4aR,7aS)-6-benzyl-4-[[3-(trifluoromethyl)phenyl]methyl]-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 56775129 |
| Molecular Formula | C21H21F3N2O2 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (4aR,7aS)-6-benzyl-4-[[3-(trifluoromethyl)phenyl]methyl]-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one |
| SMILES | O=C1CO[C@H]2CN(Cc3ccccc3)C[C@H]2N1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H21F3N2O2/c22-21(23,24)17-8-4-7-16(9-17)11-26-18-12-25(10-15-5-2-1-3-6-15)13-19(18)28-14-20(26)27/h1-9,18-19H,10-14H2/t18-,19+/m1/s1 |
| InChIKey | NSMXETXALDTOHD-MOPGFXCFSA-N |
| XLogP | 3.32 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |