C20H20F3N3O2 — CID 56775131
(4aR,7aS)-6-(pyridin-3-ylmethyl)-4-[[3-(trifluoromethyl)phenyl]methyl]-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one (PubChem CID 56775131) has the molecular formula C20H20F3N3O2 and a molecular weight of 391.39 g/mol. Its IUPAC name is (4aR,7aS)-6-(pyridin-3-ylmethyl)-4-[[3-(trifluoromethyl)phenyl]methyl]-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one.
| Compound Name | (4aR,7aS)-6-(pyridin-3-ylmethyl)-4-[[3-(trifluoromethyl)phenyl]methyl]-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 56775131 |
| Molecular Formula | C20H20F3N3O2 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (4aR,7aS)-6-(pyridin-3-ylmethyl)-4-[[3-(trifluoromethyl)phenyl]methyl]-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one |
| SMILES | O=C1CO[C@H]2CN(Cc3cccnc3)C[C@H]2N1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H20F3N3O2/c21-20(22,23)16-5-1-3-14(7-16)10-26-17-11-25(9-15-4-2-6-24-8-15)12-18(17)28-13-19(26)27/h1-8,17-18H,9-13H2/t17-,18+/m1/s1 |
| InChIKey | OMCSVPNOTSZQOU-MSOLQXFVSA-N |
| XLogP | 2.71 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |