C19H24N4O3 — CID 56775136
(4aR,7aS)-6-[(4-methoxyphenyl)methyl]-4-[(1-methylimidazol-2-yl)methyl]-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one (PubChem CID 56775136) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is (4aR,7aS)-6-[(4-methoxyphenyl)methyl]-4-[(1-methylimidazol-2-yl)methyl]-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one.
| Compound Name | (4aR,7aS)-6-[(4-methoxyphenyl)methyl]-4-[(1-methylimidazol-2-yl)methyl]-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 56775136 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (4aR,7aS)-6-[(4-methoxyphenyl)methyl]-4-[(1-methylimidazol-2-yl)methyl]-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one |
| SMILES | COc1ccc(CN2C[C@@H]3OCC(=O)N(Cc4nccn4C)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C19H24N4O3/c1-21-8-7-20-18(21)12-23-16-10-22(11-17(16)26-13-19(23)24)9-14-3-5-15(25-2)6-4-14/h3-8,16-17H,9-13H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | HUHAGXIACOAGAE-SJORKVTESA-N |
| XLogP | 1.04 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |