C13H18N4O3 — CID 56775183
(4aR,7aS)-4-(2-methoxyethyl)-6-pyrimidin-2-yl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one (PubChem CID 56775183) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is (4aR,7aS)-4-(2-methoxyethyl)-6-pyrimidin-2-yl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one.
| Compound Name | (4aR,7aS)-4-(2-methoxyethyl)-6-pyrimidin-2-yl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 56775183 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (4aR,7aS)-4-(2-methoxyethyl)-6-pyrimidin-2-yl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one |
| SMILES | COCCN1C(=O)CO[C@H]2CN(c3ncccn3)C[C@H]21 |
| InChI | InChI=1S/C13H18N4O3/c1-19-6-5-17-10-7-16(13-14-3-2-4-15-13)8-11(10)20-9-12(17)18/h2-4,10-11H,5-9H2,1H3/t10-,11+/m1/s1 |
| InChIKey | AVOHGBQYLKGPLD-MNOVXSKESA-N |
| XLogP | -0.46 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |