C14H16N2O3 — CID 56775188
(4aR,7aS)-6-acetyl-4-phenyl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one (PubChem CID 56775188) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is (4aR,7aS)-6-acetyl-4-phenyl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one.
| Compound Name | (4aR,7aS)-6-acetyl-4-phenyl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 56775188 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (4aR,7aS)-6-acetyl-4-phenyl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one |
| SMILES | CC(=O)N1C[C@@H]2OCC(=O)N(c3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C14H16N2O3/c1-10(17)15-7-12-13(8-15)19-9-14(18)16(12)11-5-3-2-4-6-11/h2-6,12-13H,7-9H2,1H3/t12-,13+/m1/s1 |
| InChIKey | KUQCISHZHNLQHE-OLZOCXBDSA-N |
| XLogP | 0.65 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |