C14H16FN3O3 — CID 56775318
(4aR,7aS)-N-(4-fluorophenyl)-4-methyl-3-oxo-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazine-6-carboxamide (PubChem CID 56775318) has the molecular formula C14H16FN3O3 and a molecular weight of 293.30 g/mol. Its IUPAC name is (4aR,7aS)-N-(4-fluorophenyl)-4-methyl-3-oxo-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazine-6-carboxamide.
| Compound Name | (4aR,7aS)-N-(4-fluorophenyl)-4-methyl-3-oxo-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazine-6-carboxamide |
|---|---|
| PubChem CID | 56775318 |
| Molecular Formula | C14H16FN3O3 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | (4aR,7aS)-N-(4-fluorophenyl)-4-methyl-3-oxo-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazine-6-carboxamide |
| SMILES | CN1C(=O)CO[C@H]2CN(C(=O)Nc3ccc(F)cc3)C[C@H]21 |
| InChI | InChI=1S/C14H16FN3O3/c1-17-11-6-18(7-12(11)21-8-13(17)19)14(20)16-10-4-2-9(15)3-5-10/h2-5,11-12H,6-8H2,1H3,(H,16,20)/t11-,12+/m1/s1 |
| InChIKey | KAGCVFFJPNYDOA-NEPJUHHUSA-N |
| XLogP | 0.90 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |