C16H20FN3O4 — CID 56775326
(4aR,7aS)-N-(4-fluorophenyl)-4-(2-methoxyethyl)-3-oxo-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazine-6-carboxamide (PubChem CID 56775326) has the molecular formula C16H20FN3O4 and a molecular weight of 337.35 g/mol. Its IUPAC name is (4aR,7aS)-N-(4-fluorophenyl)-4-(2-methoxyethyl)-3-oxo-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazine-6-carboxamide.
| Compound Name | (4aR,7aS)-N-(4-fluorophenyl)-4-(2-methoxyethyl)-3-oxo-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazine-6-carboxamide |
|---|---|
| PubChem CID | 56775326 |
| Molecular Formula | C16H20FN3O4 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | (4aR,7aS)-N-(4-fluorophenyl)-4-(2-methoxyethyl)-3-oxo-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazine-6-carboxamide |
| SMILES | COCCN1C(=O)CO[C@H]2CN(C(=O)Nc3ccc(F)cc3)C[C@H]21 |
| InChI | InChI=1S/C16H20FN3O4/c1-23-7-6-20-13-8-19(9-14(13)24-10-15(20)21)16(22)18-12-4-2-11(17)3-5-12/h2-5,13-14H,6-10H2,1H3,(H,18,22)/t13-,14+/m1/s1 |
| InChIKey | MMMJFCUDKAUZOW-KGLIPLIRSA-N |
| XLogP | 0.92 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |