C17H23N3O3 — CID 56775591
[3-[[3-[[4-(dimethylamino)phenyl]methylamino]oxetan-3-yl]methyl]-1,2-oxazol-5-yl]methanol (PubChem CID 56775591) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is [3-[[3-[[4-(dimethylamino)phenyl]methylamino]oxetan-3-yl]methyl]-1,2-oxazol-5-yl]methanol.
| Compound Name | [3-[[3-[[4-(dimethylamino)phenyl]methylamino]oxetan-3-yl]methyl]-1,2-oxazol-5-yl]methanol |
|---|---|
| PubChem CID | 56775591 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | [3-[[3-[[4-(dimethylamino)phenyl]methylamino]oxetan-3-yl]methyl]-1,2-oxazol-5-yl]methanol |
| SMILES | CN(C)c1ccc(CNC2(Cc3cc(CO)on3)COC2)cc1 |
| InChI | InChI=1S/C17H23N3O3/c1-20(2)15-5-3-13(4-6-15)9-18-17(11-22-12-17)8-14-7-16(10-21)23-19-14/h3-7,18,21H,8-12H2,1-2H3 |
| InChIKey | VVIIHCGFBVYOGZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 70.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|