About (3R)-4-(2,2-dimethylpropyl)-3-[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]morpholine
(3R)-4-(2,2-dimethylpropyl)-3-[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]morpholine (PubChem CID 56775888) has the molecular formula C19H24F3N3O
and a molecular weight of 367.42 g/mol. Its IUPAC name is (3R)-4-(2,2-dimethylpropyl)-3-[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]morpholine.
Molecular Properties
| Compound Name | (3R)-4-(2,2-dimethylpropyl)-3-[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]morpholine |
| PubChem CID | 56775888 |
| Molecular Formula | C19H24F3N3O |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | (3R)-4-(2,2-dimethylpropyl)-3-[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]morpholine |
| SMILES | CC(C)(C)CN1CCOC[C@H]1c1ncc(-c2ccc(C(F)(F)F)cc2)[nH]1 |
| InChI | InChI=1S/C19H24F3N3O/c1-18(2,3)12-25-8-9-26-11-16(25)17-23-10-15(24-17)13-4-6-14(7-5-13)19(20,21)22/h4-7,10,16H,8-9,11-12H2,1-3H3,(H,23,24)/t16-/m0/s1 |
| InChIKey | YERRXHHERJHNGX-INIZCTEOSA-N |
| XLogP | 4.51 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-4-(2,2-dimethylpropyl)-3-[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4-(2,2-dimethylpropyl)-3-[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]morpholine?
The IUPAC name of (3R)-4-(2,2-dimethylpropyl)-3-[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]morpholine (CID 56775888) is (3R)-4-(2,2-dimethylpropyl)-3-[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]morpholine.
What is the SMILES notation for (3R)-4-(2,2-dimethylpropyl)-3-[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]morpholine?
The canonical SMILES for (3R)-4-(2,2-dimethylpropyl)-3-[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]morpholine is CC(C)(C)CN1CCOC[C@H]1c1ncc(-c2ccc(C(F)(F)F)cc2)[nH]1.
What is the InChIKey of (3R)-4-(2,2-dimethylpropyl)-3-[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]morpholine?
The InChIKey is YERRXHHERJHNGX-INIZCTEOSA-N. The full InChI is InChI=1S/C19H24F3N3O/c1-18(2,3)12-25-8-9-26-11-16(25)17-23-10-15(24-17)13-4-6-14(7-5-13)19(20,21)22/h4-7,10,16H,8-9,11-12H2,1-3H3,(H,23,24)/t16-/m0/s1.
What are the key properties of (3R)-4-(2,2-dimethylpropyl)-3-[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]morpholine?
(3R)-4-(2,2-dimethylpropyl)-3-[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]morpholine has a molecular weight of 367.42 g/mol, XLogP of 4.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4-(2,2-dimethylpropyl)-3-[5-[4-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]morpholine is sourced from PubChem (CID 56775888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).