C7H6F11N — CID 56776451
3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptan-1-amine (PubChem CID 56776451) has the molecular formula C7H6F11N and a molecular weight of 313.11 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptan-1-amine.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptan-1-amine |
|---|---|
| PubChem CID | 56776451 |
| Molecular Formula | C7H6F11N |
| Molecular Weight | 313.11 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptan-1-amine |
| SMILES | NCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H6F11N/c8-3(9,1-2-19)4(10,11)5(12,13)6(14,15)7(16,17)18/h1-2,19H2 |
| InChIKey | GJWIRTQEBLHUMP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.11 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|