C14H19BFNO3 — CID 56776716
8-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 56776716) has the molecular formula C14H19BFNO3 and a molecular weight of 279.12 g/mol. Its IUPAC name is 8-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 8-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 56776716 |
| Molecular Formula | C14H19BFNO3 |
| Molecular Weight | 279.12 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 8-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CC1(C)OB(c2cc(F)c3c(c2)NCCO3)OC1(C)C |
| InChI | InChI=1S/C14H19BFNO3/c1-13(2)14(3,4)20-15(19-13)9-7-10(16)12-11(8-9)17-5-6-18-12/h7-8,17H,5-6H2,1-4H3 |
| InChIKey | ZTWAVJTUGMWQJT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.12 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|