About 3-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid;hydrochloride
3-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid;hydrochloride (PubChem CID 56777014) has the molecular formula C9H11ClN2O2S
and a molecular weight of 246.72 g/mol. Its IUPAC name is 3-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid;hydrochloride |
| PubChem CID | 56777014 |
| Molecular Formula | C9H11ClN2O2S |
| Molecular Weight | 246.72 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 3-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid;hydrochloride |
| SMILES | Cc1cn2cc(CCC(=O)O)nc2s1.Cl |
| InChI | InChI=1S/C9H10N2O2S.ClH/c1-6-4-11-5-7(2-3-8(12)13)10-9(11)14-6;/h4-5H,2-3H2,1H3,(H,12,13);1H |
| InChIKey | QKSIMVFVOOKUQC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.72 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid;hydrochloride?
The IUPAC name of 3-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid;hydrochloride (CID 56777014) is 3-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid;hydrochloride.
What is the SMILES notation for 3-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid;hydrochloride?
The canonical SMILES for 3-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid;hydrochloride is Cc1cn2cc(CCC(=O)O)nc2s1.Cl.
What is the InChIKey of 3-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid;hydrochloride?
The InChIKey is QKSIMVFVOOKUQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2S.ClH/c1-6-4-11-5-7(2-3-8(12)13)10-9(11)14-6;/h4-5H,2-3H2,1H3,(H,12,13);1H.
What are the key properties of 3-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid;hydrochloride?
3-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid;hydrochloride has a molecular weight of 246.72 g/mol, XLogP of 2.14, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylimidazo[2,1-b][1,3]thiazol-6-yl)propanoic acid;hydrochloride is sourced from PubChem (CID 56777014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).