C10H22N2O2 — CID 56777361
(3S,6S)-3,6-di(propan-2-yl)piperazine-2,5-diol (PubChem CID 56777361) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (3S,6S)-3,6-di(propan-2-yl)piperazine-2,5-diol.
| Compound Name | (3S,6S)-3,6-di(propan-2-yl)piperazine-2,5-diol |
|---|---|
| PubChem CID | 56777361 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | (3S,6S)-3,6-di(propan-2-yl)piperazine-2,5-diol |
| SMILES | CC(C)[C@@H]1NC(O)[C@H](C(C)C)NC1O |
| InChI | InChI=1S/C10H22N2O2/c1-5(2)7-9(13)12-8(6(3)4)10(14)11-7/h5-14H,1-4H3/t7-,8-,9?,10?/m0/s1 |
| InChIKey | HAISJRNRDKAUQG-DKEVHCRPSA-N |
| XLogP | -0.13 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |